62122-70-7 Usage
Uses
Used in Pharmaceutical Research and Drug Development:
1-Piperazinecarboximidamide,4-acetyl-(9CI) is used as a research compound for exploring its potential therapeutic applications in the treatment of various central nervous system disorders. Its unique structure and properties make it a valuable tool in understanding the underlying mechanisms of these conditions and in developing new treatment strategies.
Used in Central Nervous System Disorders Treatment:
In the field of neurology and psychiatry, 1-Piperazinecarboximidamide,4-acetyl-(9CI) is used as a potential therapeutic agent for the treatment of central nervous system disorders. Its specific mechanism of action and efficacy in treating these disorders are still under investigation, but its potential as a neuroprotective or neuromodulatory agent is being explored.
Used as a Potential Antipsychotic Agent:
1-Piperazinecarboximidamide,4-acetyl-(9CI) is also being studied for its potential as an antipsychotic agent. Its ability to modulate neurotransmitter systems and influence behavior makes it a candidate for further research in the development of new antipsychotic medications.
Used in Enzyme Inhibition Research:
In the realm of biochemistry and molecular biology, 1-Piperazinecarboximidamide,4-acetyl-(9CI) is used as an inhibitor of certain enzymes. Its potential to interfere with enzyme activity could lead to the development of new drugs targeting specific enzymatic pathways implicated in various diseases.
Further research is necessary to fully understand the potential applications and mechanisms of action of 1-Piperazinecarboximidamide,4-acetyl-(9CI) in various medical contexts. Its multifaceted nature as a research compound, therapeutic agent, and enzyme inhibitor highlights the importance of continued investigation into its properties and effects.
Check Digit Verification of cas no
The CAS Registry Mumber 62122-70-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,2,1,2 and 2 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 62122-70:
(7*6)+(6*2)+(5*1)+(4*2)+(3*2)+(2*7)+(1*0)=87
87 % 10 = 7
So 62122-70-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H14N4O/c1-6(12)10-2-4-11(5-3-10)7(8)9/h2-5H2,1H3,(H3,8,9)
