6219-66-5 Usage
General Description
7-acetyl-6-ethyl-9,10-dihydro-3,5,8-trihydroxy-9,10-dioxoanthracene-1,2-dicarboxylic acid is a complex organic compound with a long chemical name. It is a derivative of anthracene and contains multiple functional groups, including acetyl, ethyl, hydroxy, and carboxylic acid groups. 7-acetyl-6-ethyl-9,10-dihydro-3,5,8-trihydroxy-9,10-dioxoanthracene-1,2-dicarboxylic acid has potential applications in pharmaceuticals and dyes due to its complex structure and functional properties. It may also have antioxidant and antimicrobial properties due to the presence of multiple hydroxy groups. Further research is needed to fully understand the potential uses and effects of 7-acetyl-6-ethyl-9,10-dihydro-3,5,8-trihydroxy-9,10-dioxoanthracene-1,2-dicarboxylic acid.
Check Digit Verification of cas no
The CAS Registry Mumber 6219-66-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,2,1 and 9 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 6219-66:
(6*6)+(5*2)+(4*1)+(3*9)+(2*6)+(1*6)=95
95 % 10 = 5
So 6219-66-5 is a valid CAS Registry Number.
InChI:InChI=1/C20H14O10/c1-3-6-9(5(2)21)17(25)14-13(15(6)23)16(24)7-4-8(22)11(19(27)28)12(20(29)30)10(7)18(14)26/h4,22-23,25H,3H2,1-2H3,(H,27,28)(H,29,30)