62216-06-2 Usage
Uses
Used in Pharmaceutical Industry:
Quinoline-8-Carbothioic Acid Amide is used as a pharmaceutical agent for its potential anticancer properties, where it may contribute to the development of new drugs targeting various types of cancer. Its antimicrobial properties also make it a candidate for applications in treating microbial infections.
Used in Agrochemical Industry:
In the agrochemical sector, Quinoline-8-Carbothioic Acid Amide is utilized as a bioactive compound for its potential to combat microbial and fungal infections in crops, thereby enhancing agricultural productivity.
Used in Materials Science:
Quinoline-8-Carbothioic Acid Amide serves as a building block in materials science, where it can be used in the synthesis of new organic materials with unique properties, such as improved conductivity or stability.
Used in Coordination Chemistry:
As a ligand in coordination chemistry, Quinoline-8-Carbothioic Acid Amide is used to form coordination compounds that may exhibit novel properties, such as catalytic activity or unique electronic structures, which can be applied in various chemical processes and technologies.
Check Digit Verification of cas no
The CAS Registry Mumber 62216-06-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,2,2,1 and 6 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 62216-06:
(7*6)+(6*2)+(5*2)+(4*1)+(3*6)+(2*0)+(1*6)=92
92 % 10 = 2
So 62216-06-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H8N2S/c11-10(13)8-5-1-3-7-4-2-6-12-9(7)8/h1-6H,(H2,11,13)
