62253-94-5 Usage
Uses
Used in Pharmaceutical Industry:
2-(4-Aminobenzoyl)-2'-chloroacetanilide is used as a key intermediate in the synthesis of various pharmaceutical compounds for its ability to form targeted interactions with biological receptors and enzymes. Its distinct molecular structure makes it a valuable building block in drug development, contributing to the creation of effective analgesic and anti-inflammatory medications.
Used in Drug Development:
In the field of drug development, 2-(4-Aminobenzoyl)-2'-chloroacetanilide serves as a crucial component in the design and synthesis of new medications. Its chemical properties allow for the development of drugs with specific therapeutic targets, enhancing the efficacy and selectivity of treatments for various conditions, including pain and inflammation.
Check Digit Verification of cas no
The CAS Registry Mumber 62253-94-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,2,2,5 and 3 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 62253-94:
(7*6)+(6*2)+(5*2)+(4*5)+(3*3)+(2*9)+(1*4)=115
115 % 10 = 5
So 62253-94-5 is a valid CAS Registry Number.
InChI:InChI=1/C15H13ClN2O2/c16-12-3-1-2-4-13(12)18-15(20)9-14(19)10-5-7-11(17)8-6-10/h1-8H,9,17H2,(H,18,20)
