62285-59-0 Usage
Uses
Used in Organic Synthesis:
4-Chlorobenzaldehyde-2,3,5,6-D4 is used as a synthetic building block for the creation of various organic compounds. Its deuterated nature provides unique advantages in chemical reactions, such as improved reaction rates, enhanced selectivity, and reduced side reactions.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 4-Chlorobenzaldehyde-2,3,5,6-D4 is used as a key intermediate in the synthesis of various drugs and drug candidates. Its deuterated form offers benefits in drug development, such as increased stability and reduced metabolic degradation, leading to improved pharmacokinetic properties.
Used in Chemical Research:
4-Chlorobenzaldehyde-2,3,5,6-D4 is also employed in chemical research as a valuable tool for studying reaction mechanisms and exploring the effects of deuterium substitution on reaction rates and product selectivity. This information can be crucial for optimizing synthetic routes and developing more efficient and selective processes.
Used in Material Science:
In the field of material science, 4-Chlorobenzaldehyde-2,3,5,6-D4 can be used as a component in the development of novel materials with specific properties, such as improved thermal stability or chemical resistance. Its deuterated nature may contribute to the enhancement of these properties, making it a valuable asset in material design and development.
Check Digit Verification of cas no
The CAS Registry Mumber 62285-59-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,2,2,8 and 5 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 62285-59:
(7*6)+(6*2)+(5*2)+(4*8)+(3*5)+(2*5)+(1*9)=130
130 % 10 = 0
So 62285-59-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H5ClO/c8-7-3-1-6(5-9)2-4-7/h1-5H/i1D,2D,3D,4D
