62306-78-9 Usage
Uses
Used in Pharmaceutical Industry:
4-Formylfuran-2-boronic acid is used as a building block for the synthesis of various organic compounds, specifically in the development of pharmaceuticals. It is considered a potential drug candidate due to its capacity to inhibit the activity of certain enzymes, which can be beneficial in treating specific diseases or conditions.
Used in Agrochemical Industry:
In the agrochemical sector, 4-Formylfuran-2-boronic acid serves as a key component in the synthesis of compounds that can be utilized in the development of pesticides or other agricultural chemicals, contributing to crop protection and enhancement of yield.
Used in Catalytic Processes:
4-Formylfuran-2-boronic acid is employed as a catalyst or a catalyst precursor in various chemical reactions, facilitating transformations that may otherwise be difficult to achieve, and enhancing the efficiency of these processes.
Used as a Ligand in Coordination Chemistry:
4-FORMYLFURAN-2-BORONIC ACID also functions as a ligand in coordination chemistry, where it can bind to metal centers to form coordination complexes. Such complexes are of interest in various fields, including catalysis, materials science, and the development of new pharmaceuticals.
Overall, 4-Formylfuran-2-boronic acid is a multifaceted chemical entity with applications that span across different industries, underscoring its importance in modern chemical research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 62306-78-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,2,3,0 and 6 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 62306-78:
(7*6)+(6*2)+(5*3)+(4*0)+(3*6)+(2*7)+(1*8)=109
109 % 10 = 9
So 62306-78-9 is a valid CAS Registry Number.
InChI:InChI=1/C5H5BO4/c7-2-4-1-5(6(8)9)10-3-4/h1-3,8-9H
