62325-30-8 Usage
Uses
Used in Environmental Monitoring:
2,7-Dibromophenanthrene is used as a marker for environmental pollution, particularly in the context of monitoring the presence of halogenated PAHs in various ecosystems. Its detection can indicate exposure to industrial pollutants and help assess the environmental impact of human activities.
Used in Chemical Research:
As a halogenated PAH, 2,7-Dibromophenanthrene is utilized in chemical research to study the effects of halogenation on the properties of PAHs. This can include investigations into their reactivity, stability, and potential applications in various chemical processes.
Used in Analytical Chemistry:
2,7-Dibromophenanthrene can be employed as an analytical standard in the development and calibration of analytical methods for detecting and quantifying halogenated PAHs in environmental and industrial samples. This aids in improving the accuracy and reliability of such measurements.
Used in Toxicological Studies:
Due to its classification as an environmental pollutant, 2,7-Dibromophenanthrene is also used in toxicological studies to understand its potential effects on human health and the environment. This can involve examining its bioaccumulation, persistence, and toxicity in various organisms and ecosystems.
Check Digit Verification of cas no
The CAS Registry Mumber 62325-30-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,2,3,2 and 5 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 62325-30:
(7*6)+(6*2)+(5*3)+(4*2)+(3*5)+(2*3)+(1*0)=98
98 % 10 = 8
So 62325-30-8 is a valid CAS Registry Number.
InChI:InChI=1/C14H8Br2/c15-11-3-5-13-9(7-11)1-2-10-8-12(16)4-6-14(10)13/h1-8H