62359-01-7 Usage
Uses
Used in Chemical Synthesis Studies:
N,N-Diisopropylethylamine p-toluenesulfonate is used as a reagent in chemical synthesis for its strong basic and nucleophilic properties. It facilitates a wide range of reactions, including deprotonations, condensations, and substitutions, making it a valuable asset in the development of new compounds and materials.
Used in Pharmaceutical Chemistry:
In the pharmaceutical industry, N,N-Diisopropylethylamine p-toluenesulfonate is employed as a reagent to aid in the synthesis of various drug candidates. Its strong basic and nucleophilic nature allows for the efficient formation of target molecules, contributing to the advancement of drug discovery and development.
Used in Research and Development:
N,N-Diisopropylethylamine p-toluenesulfonate is also utilized in research and development settings, where it is employed to study the mechanisms of various chemical reactions and to optimize reaction conditions. Its use in these settings helps to expand the understanding of chemical processes and to develop more efficient synthetic methods.
Check Digit Verification of cas no
The CAS Registry Mumber 62359-01-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,2,3,5 and 9 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 62359-01:
(7*6)+(6*2)+(5*3)+(4*5)+(3*9)+(2*0)+(1*1)=117
117 % 10 = 7
So 62359-01-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H19N.C7H8O3S/c1-6-9(7(2)3)8(4)5;1-6-2-4-7(5-3-6)11(8,9)10/h7-8H,6H2,1-5H3;2-5H,1H3,(H,8,9,10)
