62406-68-2 Usage
Uses
Used in Chemical Synthesis Industry:
3-Amino-6-bromo-2,4-dichlorotoluene is used as a key intermediate in the synthesis of various organic compounds, including pharmaceuticals, agrochemicals, and dyes. Its versatile functional groups allow for further chemical reactions, making it a valuable building block for the creation of more complex molecules.
Used in Preparation of 3'',5''-Dichloro-2,2,2-Trifluoroacetophenone Derivatives:
In the specific application of preparing 3'',5''-dichloro-2,2,2-trifluoroacetophenone derivatives, 3-amino-6-bromo-2,4-dichlorotoluene serves as a crucial starting material. Its reactivity and structural features enable the formation of the desired acetophenone derivatives, which may have potential applications in various fields such as fragrances, pharmaceuticals, or materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 62406-68-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,2,4,0 and 6 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 62406-68:
(7*6)+(6*2)+(5*4)+(4*0)+(3*6)+(2*6)+(1*8)=112
112 % 10 = 2
So 62406-68-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H6BrCl2N/c1-3-4(8)2-5(9)7(11)6(3)10/h2H,11H2,1H3
62406-68-2Relevant academic research and scientific papers
Process for the preparation of 2-chloro and 2,6-dichloroanilines
-
, (2008/06/13)
2-Chloro and 2,6-dichloroanilines, optionally substituted in the 3-, 5-, and/or 6-position are prepared from the corresponding anilides by selective bromination, chlorination, reduction and hydrolysis. The selectivity of the process for introducing chlorines ortho to the amino group is very high.
