62479-28-1 Usage
Uses
Used in Chemical Synthesis:
2-Benzylacrylic Acid is used as a key intermediate in the synthesis of various chemical products, contributing to the formation of complex molecules and compounds.
Used in Pharmaceutical Industry:
2-Benzylacrylic Acid is used as a building block in the development of pharmaceutical compounds, potentially leading to the creation of new drugs and therapeutic agents.
Used in Material Science:
2-Benzylacrylic Acid is employed in the synthesis of advanced materials, such as polymers and resins, which can be utilized in various applications, including coatings, adhesives, and composites.
Used in Research and Development:
2-Benzylacrylic Acid serves as a valuable compound in academic and industrial research settings, where it is used to explore new chemical reactions, mechanisms, and potential applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 62479-28-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,2,4,7 and 9 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 62479-28:
(7*6)+(6*2)+(5*4)+(4*7)+(3*9)+(2*2)+(1*8)=141
141 % 10 = 1
So 62479-28-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H10O2/c1-8(10(11)12)7-9-5-3-2-4-6-9/h2-6H,1,7H2,(H,11,12)
