62484-76-8 Usage
Uses
Used in Pharmaceutical Industry:
5,7-Dimethylchromone-3-carboxaldehyde is used as a building block and intermediate for the synthesis of various bioactive molecules. Its potential anti-inflammatory, antioxidant, and antiviral properties make it a promising candidate for the development of new drugs.
Used in Agrochemical Industry:
In the agrochemical industry, 5,7-Dimethylchromone-3-carboxaldehyde serves as a key intermediate for the synthesis of agrochemicals, contributing to the development of effective and environmentally friendly products.
Used in Flavor and Fragrance Industry:
5,7-Dimethylchromone-3-carboxaldehyde is used as a flavor and fragrance ingredient, enhancing the aroma and taste of certain foods and beverages. Its unique chemical structure allows it to contribute to the sensory experience of various products.
Check Digit Verification of cas no
The CAS Registry Mumber 62484-76-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,2,4,8 and 4 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 62484-76:
(7*6)+(6*2)+(5*4)+(4*8)+(3*4)+(2*7)+(1*6)=138
138 % 10 = 8
So 62484-76-8 is a valid CAS Registry Number.
InChI:InChI=1/C12H10O3/c1-7-3-8(2)11-10(4-7)15-6-9(5-13)12(11)14/h3-6H,1-2H3