626-49-3 Usage
Properties
1. Chemical formula: C4H4N4S2
2. Pyrimidine derivative
3. Two amino groups
4. Two thiol groups
5. Commonly used in pharmaceutical industry
6. Used in synthesis of anti-inflammatory and anti-cancer drugs
7. Building block in development of organic compounds
8. Potential applications in materials science
9. Studied for potential as a corrosion inhibitor
Specific content
1. Molecular formula: C4H4N4S2
2. Role in pharmaceutical industry: used in synthesis of anti-inflammatory and anti-cancer agents
3. Additional applications: building block in organic compound development, potential corrosion inhibitor
4. Chemical properties: two amino groups, two thiol groups, versatile and valuable compound
Check Digit Verification of cas no
The CAS Registry Mumber 626-49-3 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 6,2 and 6 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 626-49:
(5*6)+(4*2)+(3*6)+(2*4)+(1*9)=73
73 % 10 = 3
So 626-49-3 is a valid CAS Registry Number.
InChI:InChI=1/C4H5N3S2/c5-4-6-2(8)1-3(9)7-4/h1H,(H4,5,6,7,8,9)
626-49-3Relevant articles and documents
Acyclic nucleoside bisphosphonates: Synthesis and properties of chiral 2-amino-4,6-bis[(phosphonomethoxy)alkoxy]pyrimidines
Dolakova, Petra,Dracinsky, Martin,Masojidkova, Milena,Solinova, Veronika,Kasicka, Vaclav,Holy, Antonin
experimental part, p. 2408 - 2424 (2009/09/30)
2-Amino-4,6-bis[(phosphonomethoxy)alkoxy]pyrimidines bearing two equal or different achiral or chiral phosphonoalkoxy chains have been prepared either by aromatic nucleophilic substitution of 2-amino-4,6-dichloropyrimidine or by alkylation of 4,6-dihydrox
