62662-88-8 Usage
Description
3-fluoro-5,11-dihydro-6H-dibenz[b,e]azepin-6-one is a chemical compound with the molecular formula C15H11FNO. It belongs to the class of compounds known as dibenzazepines, which are organic compounds containing a dibenzazepine moiety, a seven-membered ring with the two benzene rings at opposite ends. 3-fluoro-5,11-dihydro-6H-dibenz[b,e]azepin-6-one has a fluoro substituent at the 3 position and a ketone group at the 6 position. Its unique structure and properties make it a significant compound in the chemical and pharmaceutical industries.
Uses
Used in Pharmaceutical Research and Development:
3-fluoro-5,11-dihydro-6H-dibenz[b,e]azepin-6-one is used as a precursor or intermediate in the synthesis of various drugs. Its unique structure and properties make it a valuable compound for the development of new pharmaceuticals.
Used in Chemical Industry:
3-fluoro-5,11-dihydro-6H-dibenz[b,e]azepin-6-one is also used in the chemical industry for various applications due to its unique structure and properties. Its potential uses in this industry make it an important compound for further research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 62662-88-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,2,6,6 and 2 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 62662-88:
(7*6)+(6*2)+(5*6)+(4*6)+(3*2)+(2*8)+(1*8)=138
138 % 10 = 8
So 62662-88-8 is a valid CAS Registry Number.
InChI:InChI=1/C14H10FNO/c15-11-6-5-10-7-9-3-1-2-4-12(9)14(17)16-13(10)8-11/h1-6,8H,7H2,(H,16,17)
