6280-06-4 Usage
Uses
Used in Plastics and Polymers Industry:
Maleic acid diundecyl ester is used as a plasticizer for enhancing the flexibility, durability, and processing characteristics of various polymers and plastics, such as polyvinyl chloride (PVC) and polyester resins.
Used as a Lubricant:
In various industrial applications, maleic acid diundecyl ester serves as a lubricant, reducing friction and wear between moving parts.
Used as a Dispersant:
This chemical compound is utilized as a dispersant to promote the even distribution of particles in a medium, which is crucial in many manufacturing processes.
Used as a Surfactant:
Maleic acid diundecyl ester is employed as a surfactant, improving the stability and performance of various products by reducing surface tension and promoting the mixing of substances.
Check Digit Verification of cas no
The CAS Registry Mumber 6280-06-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,2,8 and 0 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 6280-06:
(6*6)+(5*2)+(4*8)+(3*0)+(2*0)+(1*6)=84
84 % 10 = 4
So 6280-06-4 is a valid CAS Registry Number.
InChI:InChI=1/C26H48O4/c1-3-5-7-9-11-13-15-17-19-23-29-25(27)21-22-26(28)30-24-20-18-16-14-12-10-8-6-4-2/h21-22H,3-20,23-24H2,1-2H3/b22-21-