6281-71-6 Usage
Chemical structure
Thiourea derivative with a benzoyl group and a 1,1'-biphenyl-4-yl group attached to the nitrogen atom
Application
Used as a ligand in coordination chemistry
Complex formation
Known for its ability to form complexes with various metal ions
Fields of study
Potential applications in catalysis, materials science, and medicinal chemistry
Antimicrobial properties
Investigated for its ability to inhibit the growth of microorganisms
Antioxidant properties
Studied for its potential to neutralize harmful free radicals and prevent oxidative damage
Anti-inflammatory properties
Explored for its potential to reduce inflammation and alleviate symptoms of inflammatory conditions
Wide range of potential uses
Exhibits diverse applications in different fields of science and technology
Check Digit Verification of cas no
The CAS Registry Mumber 6281-71-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,2,8 and 1 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 6281-71:
(6*6)+(5*2)+(4*8)+(3*1)+(2*7)+(1*1)=96
96 % 10 = 6
So 6281-71-6 is a valid CAS Registry Number.
InChI:InChI=1/C20H16N2OS/c23-19(17-9-5-2-6-10-17)22-20(24)21-18-13-11-16(12-14-18)15-7-3-1-4-8-15/h1-14H,(H2,21,22,23,24)