6283-88-1 Usage
General Description
6-cyclohexylhexanoic acid is a chemical compound with the molecular formula C12H22O2. It is a carboxylic acid that consists of a six-carbon cyclohexyl ring and a six-carbon straight chain. 6-cyclohexylhexanoic acid is used in the production of various industrial and consumer products, including plastics, fragrances, and pharmaceuticals. It can also be used as a precursor in the synthesis of other organic compounds. 6-cyclohexylhexanoic acid has known to exhibit anti-inflammatory and antioxidant properties, making it potentially useful in the development of new drugs for treating various health conditions. Additionally, it is considered to be relatively stable and non-toxic, which makes it a suitable candidate for various applications in chemical and pharmaceutical industries.
Check Digit Verification of cas no
The CAS Registry Mumber 6283-88-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,2,8 and 3 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 6283-88:
(6*6)+(5*2)+(4*8)+(3*3)+(2*8)+(1*8)=111
111 % 10 = 1
So 6283-88-1 is a valid CAS Registry Number.
InChI:InChI=1/C12H22O2/c13-12(14)10-6-2-5-9-11-7-3-1-4-8-11/h11H,1-10H2,(H,13,14)