6286-26-6 Usage
General Description
2-(cyclopropanecarbonyl)indene-1,3-dione, also known as CICD, is a chemical compound with a unique structure and various potential applications. It contains a cyclopropane ring and two carbonyl groups attached to an indene ring. 2-(cyclopropanecarbonyl)indene-1,3-dione has been studied for its potential as a pharmaceutical intermediate, as well as its ability to inhibit the function of certain enzymes involved in inflammation and cancer. Additionally, CICD has been investigated for its potential use in organic synthesis and material science. Its unique structure and potential biological activities make it an interesting compound for further research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 6286-26-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,2,8 and 6 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 6286-26:
(6*6)+(5*2)+(4*8)+(3*6)+(2*2)+(1*6)=106
106 % 10 = 6
So 6286-26-6 is a valid CAS Registry Number.
InChI:InChI=1/C13H10O3/c14-11(7-5-6-7)10-12(15)8-3-1-2-4-9(8)13(10)16/h1-4,7,10H,5-6H2
