6286-26-6 Usage
Uses
Used in Pharmaceutical Industry:
2-(Cyclopropanecarbonyl)indene-1,3-dione is utilized as a pharmaceutical intermediate for its potential role in the development of new drugs. Its chemical structure allows for the possibility of being a key component in the synthesis of therapeutic agents.
Used in Enzyme Inhibition:
In the field of biochemistry, 2-(cyclopropanecarbonyl)indene-1,3-dione is used as an enzyme inhibitor, targeting specific enzymes that play a role in inflammation and cancer. Its ability to inhibit these enzymes suggests potential applications in the treatment of related conditions.
Used in Organic Synthesis:
2-(Cyclopropanecarbonyl)indene-1,3-dione serves as a valuable compound in organic synthesis, where its unique structure can be employed to create a variety of complex molecules. This makes it a useful building block in the synthesis of organic compounds.
Used in Material Science:
In the realm of material science, 2-(cyclopropanecarbonyl)indene-1,3-dione is explored for its potential applications in the development of new materials. Its unique properties may contribute to the creation of advanced materials with specific characteristics for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 6286-26-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,2,8 and 6 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 6286-26:
(6*6)+(5*2)+(4*8)+(3*6)+(2*2)+(1*6)=106
106 % 10 = 6
So 6286-26-6 is a valid CAS Registry Number.
InChI:InChI=1/C13H10O3/c14-11(7-5-6-7)10-12(15)8-3-1-2-4-9(8)13(10)16/h1-4,7,10H,5-6H2
