628691-73-6 Usage
Uses
Used in Chemical Research:
3-Bromo-8-fluoroimidazo[1,2-a]pyridine is used as a research chemical for its unique properties and reactivity in various chemical reactions. Its presence in these reactions aids in the development of new compounds and the understanding of chemical behavior.
Used in Pharmaceutical Development:
In the pharmaceutical industry, 3-Bromo-8-fluoroimidazo[1,2-a]pyridine is used as a key intermediate in the synthesis of potential drug candidates. Its unique structure and functional groups make it a valuable component in the creation of new medications, particularly those targeting specific biological pathways or receptors.
Used in Material Science:
3-Bromo-8-fluoroimidazo[1,2-a]pyridine may also find applications in material science, where its chemical properties can be leveraged to develop new materials with specific characteristics, such as improved stability or reactivity in certain conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 628691-73-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,2,8,6,9 and 1 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 628691-73:
(8*6)+(7*2)+(6*8)+(5*6)+(4*9)+(3*1)+(2*7)+(1*3)=196
196 % 10 = 6
So 628691-73-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H4BrFN2/c8-6-4-10-7-5(9)2-1-3-11(6)7/h1-4H
