6289-04-9 Usage
Uses
Used in Pharmaceutical Synthesis:
1-(4-CHLOROPHENYL)-1H-PYRAZOLO[3,4-D]PYRIMIDIN-4-AMINE is used as an intermediate in the synthesis of pharmaceutical compounds, particularly in the development of drug candidates targeting various diseases. Its unique chemical structure allows for the creation of a wide range of biologically active molecules with potential therapeutic applications.
Used in Cancer Research:
In the field of cancer research, 1-(4-CHLOROPHENYL)-1H-PYRAZOLO[3,4-D]PYRIMIDIN-4-AMINE has been studied for its potential antitumor properties. Its ability to interact with various biological targets and modulate signaling pathways makes it a promising candidate for the development of novel anticancer drugs.
Used in Drug Development:
1-(4-CHLOROPHENYL)-1H-PYRAZOLO[3,4-D]PYRIMIDIN-4-AMINE's potential for medicinal applications extends to drug development, where it can be utilized to create new drug candidates with improved efficacy and selectivity. Its versatility as a building block for the synthesis of biologically active molecules makes it a valuable asset in the search for new treatments for various diseases.
Overall, 1-(4-CHLOROPHENYL)-1H-PYRAZOLO[3,4-D]PYRIMIDIN-4-AMINE is a promising chemical compound with a wide range of potential applications in the fields of pharmaceutical synthesis, cancer research, and drug development. Its unique structure and properties make it an attractive candidate for further investigation and development as a therapeutic agent.
Check Digit Verification of cas no
The CAS Registry Mumber 6289-04-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,2,8 and 9 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 6289-04:
(6*6)+(5*2)+(4*8)+(3*9)+(2*0)+(1*4)=109
109 % 10 = 9
So 6289-04-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H8ClN5/c12-7-1-3-8(4-2-7)17-11-9(5-16-17)10(13)14-6-15-11/h1-6H,(H2,13,14,15)
6289-04-9Relevant academic research and scientific papers
Synthesis and biological evaluation of some novel fused pyrazolopyrimidines as potential anticancer and antimicrobial agents
Abd El Razik, Heba A.,Abdel Wahab, Abeer E.
body text, p. 184 - 196 (2011/10/07)
Synthesis and evaluation of anticancer and antimicrobial activity of some novel pyrazolopyrimidines and fused pyrazolopyrimidines are reported. Twelve analogs were selected to be evaluated for their in vitro anticancer potential against a panel of three h
