6291-32-3 Usage
General Description
1,6-Dimethyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine is a chemical compound with the molecular formula C9H11N5. It is a pyrazolo[3,4-d]pyrimidin-4-amine derivative with two methyl groups attached to the 1 and 6 positions of the pyrazolo ring. This chemical is a potential drug candidate for various therapeutic applications, including anticancer and antitumor properties. It may also have potential applications in the field of medicinal chemistry due to its unique chemical structure and potential biological activities. However, further research and studies are needed to fully understand its pharmacological and toxicological properties.
Check Digit Verification of cas no
The CAS Registry Mumber 6291-32-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,2,9 and 1 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 6291-32:
(6*6)+(5*2)+(4*9)+(3*1)+(2*3)+(1*2)=93
93 % 10 = 3
So 6291-32-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H9N5/c1-4-10-6(8)5-3-9-12(2)7(5)11-4/h3H,1-2H3,(H2,8,10,11)
