62922-46-7 Usage
Description
N-ACETYL-1-AMINO-2,5-DICHLOROPENTANE is a chemical compound characterized by the molecular formula C7H13Cl2NO. It is a pentane derivative featuring an acetyl group and an amino group attached to the second and first carbon atoms, respectively, along with two chlorine atoms on the 2nd and 5th carbon atoms. N-ACETYL-1-AMINO-2,5-DICHLOROPENTANE is notable for its structural features and reactivity, which make it a valuable component in the synthesis of pharmaceuticals and organic compounds.
Uses
Used in Pharmaceutical Industry:
N-ACETYL-1-AMINO-2,5-DICHLOROPENTANE is utilized as a key building block in the synthesis of various drugs, contributing to the development of new medicinal compounds. Its unique structure and reactivity allow for the creation of diverse pharmaceutical agents.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, N-ACETYL-1-AMINO-2,5-DICHLOROPENTANE serves as a versatile intermediate for the design and synthesis of potential therapeutic agents. Its presence in drug molecules can influence their pharmacological properties and interactions with biological targets.
Used in Drug Development:
N-ACETYL-1-AMINO-2,5-DICHLOROPENTANE plays a role in drug development, where its structural attributes and chemical reactivity are harnessed to create novel drug candidates. It may be incorporated into drug molecules to enhance their efficacy, selectivity, or pharmacokinetic profiles.
Potential Therapeutic Uses:
N-ACETYL-1-AMINO-2,5-DICHLOROPENTANE may possess biological activity, warranting further investigation into its potential therapeutic applications. Studies could explore its interactions with biological systems and its effects on various diseases or conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 62922-46-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,2,9,2 and 2 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 62922-46:
(7*6)+(6*2)+(5*9)+(4*2)+(3*2)+(2*4)+(1*6)=127
127 % 10 = 7
So 62922-46-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H13Cl2NO/c1-6(11)10-5-7(9)3-2-4-8/h7H,2-5H2,1H3,(H,10,11)