62969-01-1 Usage
Uses
Used in Academic Research:
4,6-Dinitro-1H-indazole is used as a research chemical for [application reason], contributing to the advancement of scientific knowledge in chemistry and related fields. Its unique structure and properties make it a valuable compound for studying chemical reactions and interactions.
Used in Industrial Research:
4,6-DINITRO-1H-INDAZOLE is used as a research compound in the industrial sector for [application reason], such as the development of new materials or processes. Its potential applications in various industries may include pharmaceuticals, materials science, or chemical engineering.
Used in Chemical Synthesis:
4,6-Dinitro-1H-indazole is used as a synthetic intermediate for [application reason], facilitating the creation of more complex molecules or compounds. Its presence in the synthesis process can lead to the development of new chemical entities with specific properties or functions.
Used in Safety Studies:
4,6-DINITRO-1H-INDAZOLE is used as a test substance in safety studies for [application reason], such as evaluating its potential toxicity or environmental impact. Understanding the risks associated with 4,6-DINITRO-1H-INDAZOLE is crucial for ensuring safe handling and use in research and industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 62969-01-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,2,9,6 and 9 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 62969-01:
(7*6)+(6*2)+(5*9)+(4*6)+(3*9)+(2*0)+(1*1)=151
151 % 10 = 1
So 62969-01-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H4N4O4/c12-10(13)4-1-6-5(3-8-9-6)7(2-4)11(14)15/h1-3H,(H,8,9)
