6298-82-4 Usage
Molecular structure
The compound has two morpholine moieties, with one being a 4-carboxylic acid and the other being a 4-carbonyloxyethyl.
Esterification
The compound is formed by the esterification of morpholine-4-carboxylic acid with 2-(morpholine-4-carbonyloxy)ethyl.
Versatile chemical structure
The compound is commonly used as an intermediate in the synthesis of pharmaceuticals and agrochemicals due to its versatile chemical structure.
Building block
The compound can act as a building block for the formation of more complex organic molecules.
Potential applications
The compound may have potential applications as a solvent, a reagent, or as a precursor in organic synthesis.
Ongoing research
The specific chemical properties and potential uses of the compound are still under investigation, and further research into its applications and potential benefits is ongoing.
Check Digit Verification of cas no
The CAS Registry Mumber 6298-82-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,2,9 and 8 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 6298-82:
(6*6)+(5*2)+(4*9)+(3*8)+(2*8)+(1*2)=124
124 % 10 = 4
So 6298-82-4 is a valid CAS Registry Number.
InChI:InChI=1/C12H20N2O6/c15-11(13-1-5-17-6-2-13)19-9-10-20-12(16)14-3-7-18-8-4-14/h1-10H2
