62984-74-1 Usage
Chemical structure
A complex chemical compound with a long and specific name.
Pyridinium chloride compound
Contains a pyridinium group and a chloride ion.
Cyano group
Contains a carbon-nitrogen triple bond (C≡N).
Dimethylamino group
Contains two methyl groups (CH3) attached to a nitrogen atom (N).
Allyl group
A group derived from propene, with a double bond and a single bond to the rest of the molecule.
Oxo group
A carbonyl group (C=O) attached to a carbon atom.
Laboratory research
Commonly used in laboratory research for various purposes.
Medical applications
Utilized in the field of pharmaceuticals.
Potentially hazardous
Important to handle and use with care and under proper guidance due to its potentially hazardous nature.
Check Digit Verification of cas no
The CAS Registry Mumber 62984-74-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,2,9,8 and 4 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 62984-74:
(7*6)+(6*2)+(5*9)+(4*8)+(3*4)+(2*7)+(1*4)=161
161 % 10 = 1
So 62984-74-1 is a valid CAS Registry Number.
InChI:InChI=1/C19H20N3O2.ClH/c1-21(2)18-8-6-16(7-9-18)14-17(15-20)19(23)24-13-12-22-10-4-3-5-11-22;/h3-11,14H,12-13H2,1-2H3;1H/q+1;/p-1/b17-14+;
