6301-46-8 Usage
Uses
Used in Analytical Chemistry:
5,5-Bis(propan-2-ylsulfanyl)pentane-1,2,3-triol is used as a chelating agent for stabilizing metal ions in solution and preventing their precipitation. This application is crucial in analytical chemistry to ensure accurate measurements and analysis of metal ion concentrations.
Used in Pharmaceutical Industry:
5,5-Bis(propan-2-ylsulfanyl)pentane-1,2,3-triol is used as a potential therapeutic agent due to its antioxidant and anti-inflammatory properties. Its ability to bind metal ions may contribute to its therapeutic effects, making it a promising candidate for the development of new drugs and treatments.
Used in Environmental Applications:
5,5-Bis(propan-2-ylsulfanyl)pentane-1,2,3-triol can be used as a metal-chelating agent in environmental remediation processes. Its ability to bind metal ions can help in the removal of heavy metals from contaminated water and soil, contributing to environmental protection and restoration efforts.
Used in Material Science:
5,5-Bis(propan-2-ylsulfanyl)pentane-1,2,3-triol can be used in the development of new materials with specific properties. Its metal-chelating ability can be utilized to create materials with enhanced stability, reactivity, or other desired characteristics, making it a valuable component in material science research and development.
Used in Chemical Synthesis:
5,5-Bis(propan-2-ylsulfanyl)pentane-1,2,3-triol can be used as a starting material or intermediate in the synthesis of other organic compounds. Its unique structure and functional groups make it a versatile building block for the creation of new molecules with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 6301-46-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,0 and 1 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 6301-46:
(6*6)+(5*3)+(4*0)+(3*1)+(2*4)+(1*6)=68
68 % 10 = 8
So 6301-46-8 is a valid CAS Registry Number.
InChI:InChI=1/C11H24O3S2/c1-7(2)15-11(16-8(3)4)5-9(13)10(14)6-12/h7-14H,5-6H2,1-4H3
