6301-66-2 Usage
Uses
Used in Pharmaceutical and Chemical Industries:
2-benzyl-5-methyl-5-propyl-1,3-dioxane is used as a solvent for various pharmaceutical and chemical processes. Its ability to dissolve a wide range of substances makes it an ideal choice for dissolving active pharmaceutical ingredients and facilitating chemical reactions.
Used in Fragrance Industry:
This chemical compound is also used as a fragrance ingredient in perfumes and personal care products. Its pleasant aroma and stability make it a popular choice for enhancing the scent of various products.
Used in Organic Synthesis:
2-benzyl-5-methyl-5-propyl-1,3-dioxane has potential applications in the synthesis of organic compounds. Its unique structure allows it to participate in various organic reactions, contributing to the formation of desired products.
Used as a Reagent in Organic Chemistry Reactions:
Due to its reactivity and stability, 2-benzyl-5-methyl-5-propyl-1,3-dioxane is utilized as a reagent in various organic chemistry reactions. It can act as a catalyst or a reactant, aiding in the synthesis of complex organic molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 6301-66-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,0 and 1 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 6301-66:
(6*6)+(5*3)+(4*0)+(3*1)+(2*6)+(1*6)=72
72 % 10 = 2
So 6301-66-2 is a valid CAS Registry Number.
InChI:InChI=1/C15H22O2/c1-3-9-15(2)11-16-14(17-12-15)10-13-7-5-4-6-8-13/h4-8,14H,3,9-12H2,1-2H3
