6302-46-1 Usage
Explanation
The molecular formula represents the number of atoms of each element present in a molecule. In this case, the compound has 16 carbon (C) atoms, 24 hydrogen (H) atoms, 1 chlorine (Cl) atom, and 1 nitrogen (N) atom.
Explanation
Aryl-alkylamines are a class of organic compounds that contain an alkylamine group (an amine with an alkyl group attached) N-linked to an aryl group (a group derived from an aromatic ring, such as a phenyl group).
Explanation
The structure describes the arrangement of atoms and functional groups in the molecule. In this case, the molecule has a 4-chlorophenyl group attached to a nitrogen atom, which is in turn connected to a 4-methylpentan-2-yl group and an ethanimine (imine) group.
Explanation
Synonyms are alternative names for a chemical compound, often used to describe the same molecule in different ways or from different perspectives.
Explanation
This chemical compound is used in the research and development of potential drug candidates, as it may possess biologically active properties or serve as a building block for more complex molecules.
Explanation
The properties and potential uses of 1-(4-chlorophenyl)-N-(4-methylpentan-2-yl)ethanimine may differ based on the context in which it is being studied or utilized, such as its role in a specific drug development project or its interaction with other molecules.
Explanation
The solubility of a compound refers to its ability to dissolve in a particular solvent. The solubility of 1-(4-chlorophenyl)-N-(4-methylpentan-2-yl)ethanimine is not provided in the material, but it may vary depending on the solvent used and the conditions under which it is tested.
Explanation
The stability of a compound refers to its ability to maintain its structure and properties over time. The stability of 1-(4-chlorophenyl)-N-(4-methylpentan-2-yl)ethanimine is not provided in the material, but it may be influenced by factors such as storage conditions, temperature, and exposure to light or air.
Class
Aryl-alkylamines
Structure
1-(4-chlorophenyl)-N-(4-methylpentan-2-yl)ethanimine
Synonyms
N-(4-methyl-2-pentyl)(4-chlorophenyl)methylamine
Application
Pharmaceutical research and synthesis
Potential Uses
Varies depending on specific application and intended use
Solubility
Unknown (may vary depending on solvents and conditions)
Stability
Unknown (may depend on storage and handling conditions)
Check Digit Verification of cas no
The CAS Registry Mumber 6302-46-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,0 and 2 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 6302-46:
(6*6)+(5*3)+(4*0)+(3*2)+(2*4)+(1*6)=71
71 % 10 = 1
So 6302-46-1 is a valid CAS Registry Number.
InChI:InChI=1/C14H20ClN/c1-10(2)9-11(3)16-12(4)13-5-7-14(15)8-6-13/h5-8,10-11H,9H2,1-4H3/b16-12+
