63034-96-8 Usage
General Description
N-(3-chloro-2-methyl-phenyl)-2-cyano-acetamide is a chemical compound that features a benzene ring with a chloride substituent and a methyl group attached. The compound also contains a cyano group and an acetamide group. It is commonly used in the pharmaceutical industry as an intermediate in the synthesis of various drugs. N-(3-chloro-2-methyl-phenyl)-2-cyano-acetamide may also have potential applications in the development of new materials, such as polymers and coatings. Its unique structure and properties make it a valuable building block for the creation of complex organic molecules. However, as with any chemical compound, proper handling and safety precautions should be observed when working with N-(3-chloro-2-methyl-phenyl)-2-cyano-acetamide to minimize potential hazards and risks.
Check Digit Verification of cas no
The CAS Registry Mumber 63034-96-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,0,3 and 4 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 63034-96:
(7*6)+(6*3)+(5*0)+(4*3)+(3*4)+(2*9)+(1*6)=108
108 % 10 = 8
So 63034-96-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H9ClN2O/c1-7-8(11)3-2-4-9(7)13-10(14)5-6-12/h2-4H,5H2,1H3,(H,13,14)
