6304-11-6 Usage
Hydrazine derivative
A compound based on hydrazine (N2H4) This compound is derived from hydrazine, which is a simple inorganic compound consisting of two nitrogen atoms and four hydrogen atoms. In this case, the hydrazine part of the molecule is modified with two phenyl rings.
Chloro group present
A chlorine atom attached to the 4-position of one phenyl ring One of the phenyl rings in the compound contains a chlorine atom at the 4-position, which influences the reactivity and properties of the molecule.
Dimethyl groups present
Two methyl groups attached to the 3and 5-positions of one phenyl ring The same phenyl ring as the chloro group also has two methyl groups at the 3and 5-positions, further affecting the molecule's properties and reactivity.
Dibromophenyl group present
Two bromine atoms attached to the 3and 5-positions of the other phenyl ring The second phenyl ring in the compound contains two bromine atoms at the 3and 5-positions, which can impact the molecule's stability, reactivity, and solubility.
Used in biochemical and pharmaceutical research
Building block for the synthesis of various organic compounds This compound is often utilized as a starting material or intermediate in the synthesis of other organic compounds, particularly in the fields of biochemistry and pharmaceuticals.
Potential applications in drug development
Development of new drugs and therapeutic agents Due to its unique structure and reactivity, this compound may be useful in the creation of new drugs and therapies for various medical conditions.
Possible uses in material science
Precursor for the preparation of functional materials with specific properties The compound's complex structure and properties make it a potentially valuable precursor for the synthesis of materials with tailored characteristics for specific applications.
Complex structure and properties
Further studies necessary to understand potential applications and impacts Given the intricate nature of this compound, more research is needed to fully explore its possible uses and any potential consequences or benefits associated with its application in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 6304-11-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,0 and 4 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 6304-11:
(6*6)+(5*3)+(4*0)+(3*4)+(2*1)+(1*1)=66
66 % 10 = 6
So 6304-11-6 is a valid CAS Registry Number.
InChI:InChI=1/C14H13Br2ClN2/c1-8-3-12(4-9(2)14(8)17)18-19-13-6-10(15)5-11(16)7-13/h3-7,18-19H,1-2H3
