63041-19-0 Usage
Description
4-[(pyridin-4-ylcarbonyl)hydrazono]heptanedioic acid is a chemical compound characterized by the molecular formula C15H15N3O6. It is an organic acid that features a pyridine ring and a hydrazine group, which contribute to its unique structural and reactivity properties. 4-[(pyridin-4-ylcarbonyl)hydrazono]heptanedioic acid holds promise for various applications due to its potential as a precursor in the synthesis of a range of organic compounds and its possible biological activity.
Uses
Used in Pharmaceutical Industry:
4-[(pyridin-4-ylcarbonyl)hydrazono]heptanedioic acid is used as a precursor in the synthesis of pharmaceutical compounds for its ability to contribute to the development of new drugs with potential therapeutic effects. Its structural features may allow for the creation of molecules with specific biological activities, making it a valuable component in medicinal chemistry.
Used in Agrochemical Industry:
In the agrochemical sector, 4-[(pyridin-4-ylcarbonyl)hydrazono]heptanedioic acid is utilized as a starting material for the production of agrochemicals, such as pesticides and herbicides. Its reactivity and structural attributes can be harnessed to design effective compounds that address various agricultural challenges.
Further Research and Development:
4-[(pyridin-4-ylcarbonyl)hydrazono]heptanedioic acid is a subject of ongoing research and development to explore its full potential in different fields. Its applications may extend beyond the pharmaceutical and agrochemical industries as new uses and properties are discovered through scientific inquiry and innovation.
Check Digit Verification of cas no
The CAS Registry Mumber 63041-19-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,0,4 and 1 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 63041-19:
(7*6)+(6*3)+(5*0)+(4*4)+(3*1)+(2*1)+(1*9)=90
90 % 10 = 0
So 63041-19-0 is a valid CAS Registry Number.
InChI:InChI=1/C13H15N3O5/c17-11(18)3-1-10(2-4-12(19)20)15-16-13(21)9-5-7-14-8-6-9/h5-8H,1-4H2,(H,16,21)(H,17,18)(H,19,20)
