63041-50-9 Usage
Uses
Used in Pharmaceutical Research:
6,12b-Dihydro-3-Methylcholanthrene is used as a research compound in the pharmaceutical industry for studying the mechanisms of carcinogenesis and the development of cancer. Its unique chemical structure allows researchers to investigate the interactions between polycyclic aromatic hydrocarbons and biological systems, providing insights into the molecular basis of cancer initiation and progression.
Used in Toxicological Studies:
In toxicology, 6,12b-Dihydro-3-Methylcholanthrene is employed as a model compound to evaluate the toxic effects of polycyclic aromatic hydrocarbons on living organisms. Its use in these studies helps to understand the dose-response relationships, metabolic pathways, and potential health risks associated with exposure to similar environmental pollutants.
Used in Environmental Monitoring:
6,12b-Dihydro-3-Methylcholanthrene can be used as an indicator compound in environmental monitoring programs to assess the presence and concentration of polycyclic aromatic hydrocarbons in air, water, and soil samples. This information is crucial for evaluating the potential health risks and implementing appropriate pollution control measures.
Used in Chemical Synthesis:
In the field of organic chemistry, 6,12b-Dihydro-3-Methylcholanthrene serves as a starting material or intermediate in the synthesis of various complex organic molecules and pharmaceutical agents. Its unique structure and reactivity make it a valuable component in the development of novel chemical entities with potential therapeutic applications.
Used in Material Science:
6,12b-Dihydro-3-Methylcholanthrene has potential applications in material science, particularly in the development of advanced materials with specific optical, electronic, or structural properties. Its incorporation into polymers, composites, or other materials can lead to the creation of innovative products with improved performance characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 63041-50-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,0,4 and 1 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 63041-50:
(7*6)+(6*3)+(5*0)+(4*4)+(3*1)+(2*5)+(1*0)=89
89 % 10 = 9
So 63041-50-9 is a valid CAS Registry Number.
InChI:InChI=1/C21H18/c1-13-6-7-15-12-20-17-5-3-2-4-14(17)8-9-18(20)19-11-10-16(13)21(15)19/h2-9,19H,10-12H2,1H3
