6305-60-8 Usage
General Description
Ethyl 3-acetyloxy-3-cyclohexyl-2-methylpropanoate is a chemical compound characterized by its specific molecular structure, consisting of an ethyl ester group, an acetyloxy group, and a cyclohexyl-methylpropanoate moiety. Ethyl 3-acetyloxy-3-cyclohexyl-2-methylpropanoate exhibits a combination of acetyl, cyclohexyl, and ethyl functional groups, imparting unique chemical properties and potential applications. The presence of the cyclohexyl ring suggests potential stereochemical considerations in its reactivity, making it intriguing for synthetic and medicinal chemistry applications.
Check Digit Verification of cas no
The CAS Registry Mumber 6305-60-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,0 and 5 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 6305-60:
(6*6)+(5*3)+(4*0)+(3*5)+(2*6)+(1*0)=78
78 % 10 = 8
So 6305-60-8 is a valid CAS Registry Number.
InChI:InChI=1/C14H24O4/c1-4-17-14(16)10(2)13(18-11(3)15)12-8-6-5-7-9-12/h10,12-13H,4-9H2,1-3H3
