63059-64-3 Usage
Uses
Used in Fluorescence Microscopy and Imaging Techniques:
2,3-dimethyl-5-phenylbenzoxazolium p-toluenesulphonate is used as a fluorescent marker for fluorescence microscopy and other imaging techniques due to its specific excitation and emission wavelengths, allowing for the visualization of cellular structures and molecules.
Used in Cell Biology and Biochemistry Research:
In cell biology and biochemistry research, 2,3-dimethyl-5-phenylbenzoxazolium p-toluenesulphonate is used as a labeling agent to mark specific cellular structures and molecules, facilitating the study of their functions and interactions within biological systems.
Used as a pH Indicator:
2,3-dimethyl-5-phenylbenzoxazolium p-toluenesulphonate is used as a pH indicator in various analytical and diagnostic tests, providing a visual readout of pH changes in different environments.
Used as a Molecular Probe:
In analytical chemistry, 2,3-dimethyl-5-phenylbenzoxazolium p-toluenesulphonate is employed as a molecular probe, enabling the detection and analysis of specific molecules or chemical interactions in complex systems.
Check Digit Verification of cas no
The CAS Registry Mumber 63059-64-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,0,5 and 9 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 63059-64:
(7*6)+(6*3)+(5*0)+(4*5)+(3*9)+(2*6)+(1*4)=123
123 % 10 = 3
So 63059-64-3 is a valid CAS Registry Number.
InChI:InChI=1/C15H14NO.C7H8O3S/c1-11-16(2)14-10-13(8-9-15(14)17-11)12-6-4-3-5-7-12;1-6-2-4-7(5-3-6)11(8,9)10/h3-10H,1-2H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1
63059-64-3Relevant academic research and scientific papers
POLYMETHINE COMPOUND
-
Paragraph 0067-0070, (2019/10/22)
The present invention relates to a polymethine compound which can be useful in a hard coating composition or an adhesive composition. The polymethine compound is represented by chemical formula 1. In chemical formula 1, X and Y are each independently O, S or NR11, and R11 is a C1 to C12 aliphatic hydrocarbon group.COPYRIGHT KIPO 2019
