6306-72-5 Usage
Uses
Used in Food Industry:
Benzoic acid is used as a preservative to prevent the growth of mold, yeast, and some bacteria in various food products. Its effectiveness as a preservative is attributed to its ability to penetrate these microorganisms and disrupt their cellular processes, thereby extending the shelf life of the food.
Used in Pharmaceutical Industry:
3-phenylbutan-2-amine is used as a precursor in the synthesis of various pharmaceuticals. Its unique chemical structure allows it to be a versatile building block in the creation of a wide range of medications, contributing to the development of new treatments and therapies.
Used in Chemical Industry:
Benzoic acid is used in the production of dyes and perfumes, where its aromatic properties contribute to the color and scent of these products. Its presence in these industries is essential for creating a diverse array of colorants and fragrances.
Used in Organic Synthesis:
3-phenylbutan-2-amine serves as an intermediate in organic reactions, playing a crucial role in the synthesis of complex organic compounds. Its reactivity and structural features make it a valuable component in the development of new chemical processes and products.
Check Digit Verification of cas no
The CAS Registry Mumber 6306-72-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,0 and 6 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 6306-72:
(6*6)+(5*3)+(4*0)+(3*6)+(2*7)+(1*2)=85
85 % 10 = 5
So 6306-72-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H15N.C7H6O2/c1-8(9(2)11)10-6-4-3-5-7-10;8-7(9)6-4-2-1-3-5-6/h3-9H,11H2,1-2H3;1-5H,(H,8,9)
