6310-02-7 Usage
General Description
2-amino-6-chloro-1H-pyrimidine-4-thione is a chemical compound with the molecular formula C4H3ClN2S. It is a derivative of pyrimidine and is classified as a thione, containing a sulfur atom within its structure. 2-amino-6-chloro-1H-pyrimidine-4-thione is commonly used in organic synthesis and pharmaceutical research due to its potential as a building block for the production of various bioactive compounds. It has been studied for its potential pharmacological activities, including as an antimicrobial and anticancer agent. Additionally, 2-amino-6-chloro-1H-pyrimidine-4-thione has been investigated as a potential intermediate for the synthesis of various heterocyclic compounds and pharmaceutical drugs.
Check Digit Verification of cas no
The CAS Registry Mumber 6310-02-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,1 and 0 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 6310-02:
(6*6)+(5*3)+(4*1)+(3*0)+(2*0)+(1*2)=57
57 % 10 = 7
So 6310-02-7 is a valid CAS Registry Number.
InChI:InChI=1/C4H4ClN3S/c5-2-1-3(9)8-4(6)7-2/h1H,(H3,6,7,8,9)
