6310-04-9 Usage
Uses
Used in Pharmaceutical and Agrochemical Industries:
1-(5-chloro-2-thienyl)ethan-1-one is utilized as a crucial intermediate in the synthesis of a wide array of pharmaceuticals and agrochemicals. Its unique chemical structure allows for the creation of diverse compounds with specific therapeutic or pesticidal properties, making it an indispensable component in these industries.
Used in the Food Industry:
In the realm of the food industry, 1-(5-chloro-2-thienyl)ethan-1-one serves as a flavoring agent. Its distinct pungent odor and taste contribute to the enhancement of flavors in various food products, providing consumers with a more diverse and enjoyable sensory experience.
Safety Precautions:
Check Digit Verification of cas no
The CAS Registry Mumber 6310-04-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,1 and 0 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 6310-04:
(6*6)+(5*3)+(4*1)+(3*0)+(2*0)+(1*4)=59
59 % 10 = 9
So 6310-04-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H8N2S2/c1-4-3-5(9)8-6(7-4)10-2/h3H,1-2H3,(H,7,8,9)
