6310-34-5 Usage
Uses
Used in Organic Chemistry:
2-(decylsulfanylmethyl)isoindole-1,3-dione is used as a building block for the synthesis of various organic compounds due to its distinctive chemical structure and reactivity.
Used in Pharmaceutical Industry:
2-(decylsulfanylmethyl)isoindole-1,3-dione is used as a potential pharmaceutical candidate for the development of new drugs, leveraging its unique structure and potential biological activity. Further research is needed to understand its therapeutic potential and mechanism of action.
Check Digit Verification of cas no
The CAS Registry Mumber 6310-34-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,1 and 0 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 6310-34:
(6*6)+(5*3)+(4*1)+(3*0)+(2*3)+(1*4)=65
65 % 10 = 5
So 6310-34-5 is a valid CAS Registry Number.
InChI:InChI=1/C19H27NO2S/c1-2-3-4-5-6-7-8-11-14-23-15-20-18(21)16-12-9-10-13-17(16)19(20)22/h9-10,12-13H,2-8,11,14-15H2,1H3
