6310-34-5 Usage
General Description
2-(decylsulfanylmethyl)isoindole-1,3-dione is a chemical compound with the molecular formula C21H27NO2S. It is a type of isoindole-1,3-dione compound with a decylsulfanyl methyl group attached to one of its carbon atoms. 2-(decylsulfanylmethyl)isoindole-1,3-dione may have potential applications in the field of organic chemistry and pharmaceuticals due to its unique structure and potential biological activity. Further research is needed to fully understand the properties and potential uses of 2-(decylsulfanylmethyl)isoindole-1,3-dione.
Check Digit Verification of cas no
The CAS Registry Mumber 6310-34-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,1 and 0 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 6310-34:
(6*6)+(5*3)+(4*1)+(3*0)+(2*3)+(1*4)=65
65 % 10 = 5
So 6310-34-5 is a valid CAS Registry Number.
InChI:InChI=1/C19H27NO2S/c1-2-3-4-5-6-7-8-11-14-23-15-20-18(21)16-12-9-10-13-17(16)19(20)22/h9-10,12-13H,2-8,11,14-15H2,1H3
