6311-09-7 Usage
Molecular structure
Consists of a morpholine-4-carbonyloxy group attached to an ethoxyethyl group and another morpholine-4-carboxylate group.
Type of compound
Ester.
Number of morpholine groups
Two.
Usage
Building block in organic synthesis and pharmaceutical research.
Versatility
Unique structure with two morpholine groups allows for the development of various pharmaceuticals and bioactive molecules.
Application
Can be used as a reagent in chemical reactions for the synthesis of complex organic compounds.
Value
Has potential applications in drug discovery and organic chemistry, making it a valuable compound in the field of chemical research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 6311-09-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,1 and 1 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 6311-09:
(6*6)+(5*3)+(4*1)+(3*1)+(2*0)+(1*9)=67
67 % 10 = 7
So 6311-09-7 is a valid CAS Registry Number.
InChI:InChI=1/C19H18Cl2N2O2S/c1-2-11-3-5-13-14(9-22)19(26-17(13)7-11)23-18(24)10-25-16-8-12(20)4-6-15(16)21/h4,6,8,11H,2-3,5,7,10H2,1H3,(H,23,24)