6311-83-7 Usage
Uses
Used in Pharmaceutical Industry:
6-Mercapto-4(1H)-pyrimidinone is utilized as a synthetic intermediate for the development of various pharmaceuticals. Its unique structure allows for the creation of new drug candidates with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical sector, 6-Mercapto-4(1H)-pyrimidinone is employed as a precursor in the synthesis of agrochemicals, contributing to the development of effective pest control agents and other agricultural products.
Used in Materials Science:
6-Mercapto-4(1H)-pyrimidinone is used as a building block in the synthesis of novel materials with specific properties, such as conductive polymers or materials with unique optical characteristics.
Used as an Enzyme Inhibitor:
6-Mercapto-4(1H)-pyrimidinone is studied for its potential as an enzyme inhibitor, which could have implications in the treatment of various diseases by modulating enzyme activity.
Used in Anti-Cancer Research:
6-Mercapto-4(1H)-pyrimidinone is explored for its anti-cancer properties, with the potential to target and inhibit the growth of cancer cells, offering a new avenue for cancer therapy.
Used in Anti-Viral Applications:
6-Mercapto-4(1H)-pyrimidinone is also considered for its anti-viral potential, suggesting a possible role in the development of treatments for viral infections.
Used in Coordination Chemistry:
Due to its ability to form coordination complexes with metal cations, 6-Mercapto-4(1H)-pyrimidinone is applied in coordination chemistry, which can lead to the discovery of new materials with specialized functions in areas such as catalysis, sensing, and drug delivery.
Check Digit Verification of cas no
The CAS Registry Mumber 6311-83-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,1 and 1 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 6311-83:
(6*6)+(5*3)+(4*1)+(3*1)+(2*8)+(1*3)=77
77 % 10 = 7
So 6311-83-7 is a valid CAS Registry Number.
InChI:InChI=1/C4H4N2OS/c7-3-1-4(8)6-2-5-3/h1-2H,(H2,5,6,7,8)
