6311-99-5

Usage

Uses

Used in Pharmaceutical Synthesis:
N-(2-pyridin-2-ylethyl)pyridin-2-amine is used as a key intermediate in the development of pharmaceutical compounds. Its unique structure allows it to be a versatile component in the creation of various medicinal agents, contributing to the advancement of new treatments and therapies.
Used in Agrochemical Development:
In the agrochemical industry, N-(2-pyridin-2-ylethyl)pyridin-2-amine serves as a crucial building block for the synthesis of pesticides and other crop protection agents. Its incorporation into these products can enhance their effectiveness and selectivity, leading to improved agricultural outcomes.
Used in Organic Chemistry Research:
N-(2-pyridin-2-ylethyl)pyridin-2-amine is also utilized in research settings for its distinctive structural properties. It aids chemists in exploring new reactions and mechanisms, potentially leading to the discovery of novel organic compounds and processes.
Used in Drug Discovery:
N-(2-pyridin-2-ylethyl)pyridin-2-amine plays a significant role in drug discovery, where its unique structure can be leveraged to design and develop new pharmaceutical entities. Its presence in a molecule can influence properties such as solubility, stability, and binding affinity, which are critical in the optimization of drug candidates.
Overall, N-(2-pyridin-2-ylethyl)pyridin-2-amine is a valuable chemical with a wide range of applications across different industries, and it holds significant potential for further scientific and industrial uses.

InChI:InChI=1/C12H13N3/c1-3-8-13-11(5-1)7-10-15-12-6-2-4-9-14-12/h1-6,8-9H,7,10H2,(H,14,15)