6312-04-5 Usage
Uses
Used in Biomedical Research:
2-(2-PIPERIDIN-2-YLETHYL)PYRIDINE is used as a building block for the synthesis of pharmacological compounds due to its cyclic structure and potential influence on the properties of the resulting compounds.
Used in Organic Chemistry:
In the field of organic chemistry, 2-(2-PIPERIDIN-2-YLETHYL)PYRIDINE is used as a component in the synthesis of complex molecules, leveraging its specific structure to create new chemical entities.
Used in Medicinal Chemistry:
2-(2-PIPERIDIN-2-YLETHYL)PYRIDINE is used as a target for research and development in medicinal chemistry, given its pharmacological properties and potential applications in drug discovery and development.
Check Digit Verification of cas no
The CAS Registry Mumber 6312-04-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,1 and 2 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 6312-04:
(6*6)+(5*3)+(4*1)+(3*2)+(2*0)+(1*4)=65
65 % 10 = 5
So 6312-04-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H18N2/c1-3-9-13-11(5-1)7-8-12-6-2-4-10-14-12/h1,3,5,9,12,14H,2,4,6-8,10H2
