6312-50-1 Usage
Uses
Used in Pharmacology Research:
N-(4-Bromobenzoyl)-4-methylpiperazine-1-carboxamide is used as a potential ligand for receptor studies, allowing researchers to explore its interactions with various biological targets. This application aids in understanding the compound's potential therapeutic effects and mechanisms of action.
Used in Drug Synthesis:
As a starting material for the synthesis of other bioactive molecules, N-(4-Bromobenzoyl)-4-methylpiperazine-1-carboxamide plays a crucial role in the development of new drugs for various medical conditions. Its chemical structure provides a foundation for the creation of novel compounds with potential therapeutic applications.
Used in Medicinal Chemistry:
N-(4-Bromobenzoyl)-4-methylpiperazine-1-carboxamide's unique structure and properties make it suitable for further investigation in medicinal chemistry. Researchers can utilize N-(4-Bromobenzoyl)-4-methylpiperazine-1-carboxamide to design and develop new pharmaceutical agents, potentially leading to breakthroughs in the treatment of various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 6312-50-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,1 and 2 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 6312-50:
(6*6)+(5*3)+(4*1)+(3*2)+(2*5)+(1*0)=71
71 % 10 = 1
So 6312-50-1 is a valid CAS Registry Number.
InChI:InChI=1/C13H16BrN3O2/c1-16-6-8-17(9-7-16)13(19)15-12(18)10-2-4-11(14)5-3-10/h2-5H,6-9H2,1H3,(H,15,18,19)
