6312-71-6 Usage
Uses
Used in Organic Synthesis:
6-AMINO-5-BROMOPYRIMIDIN-4(3H)-ONE is used as a key intermediate in organic synthesis for the creation of a range of chemical compounds. Its unique structure and reactivity make it a valuable component in the development of new organic molecules with potential applications in various industries.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 6-AMINO-5-BROMOPYRIMIDIN-4(3H)-ONE is utilized as a building block for the synthesis of bioactive molecules and pharmaceuticals. Its properties and structure contribute to the discovery and development of new drugs with therapeutic potential, enhancing the treatment options for various diseases and conditions.
Used in Medicinal Chemistry:
6-AMINO-5-BROMOPYRIMIDIN-4(3H)-ONE plays a significant role in medicinal chemistry, where it is employed for the design and synthesis of novel compounds with potential medicinal properties. Its versatility allows researchers to explore its use in the development of new therapeutic agents, contributing to advancements in healthcare and medicine.
Check Digit Verification of cas no
The CAS Registry Mumber 6312-71-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,1 and 2 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 6312-71:
(6*6)+(5*3)+(4*1)+(3*2)+(2*7)+(1*1)=76
76 % 10 = 6
So 6312-71-6 is a valid CAS Registry Number.
InChI:InChI=1/C4H4BrN3O/c5-2-3(6)7-1-8-4(2)9/h1H,(H3,6,7,8,9)
