6317-12-0 Usage
Uses
Used in Chemical Research:
2-(4-chlorophenyl)-5,6-dihydro-1,4-dithiine is used as a research chemical for the development of novel compounds and materials. Its unique structure allows for the exploration of new chemical reactions and the synthesis of bioactive molecules.
Used in Pharmaceutical Development:
In the pharmaceutical industry, 2-(4-chlorophenyl)-5,6-dihydro-1,4-dithiine is used as a key intermediate in the synthesis of new drugs and bioactive compounds. Its presence in the molecular structure can contribute to the desired pharmacological properties of the final product.
Used in Organic Synthesis:
2-(4-chlorophenyl)-5,6-dihydro-1,4-dithiine is utilized as a versatile building block in organic synthesis. Its reactivity and structural features enable the creation of a wide range of organic molecules with potential applications in various fields, including medicine, agriculture, and materials science.
It is crucial to handle 2-(4-chlorophenyl)-5,6-dihydro-1,4-dithiine with care due to its potential health and safety risks. Proper management and safety measures should be implemented to minimize any risks associated with its use in research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 6317-12-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,1 and 7 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 6317-12:
(6*6)+(5*3)+(4*1)+(3*7)+(2*1)+(1*2)=80
80 % 10 = 0
So 6317-12-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H9ClS2/c11-9-3-1-8(2-4-9)10-7-12-5-6-13-10/h1-4,7H,5-6H2
