6317-17-5 Usage
Chemical class
Thioester derivative of acetic acid
Morpholine ring
Provides basic functionality
Thiol group
Reactive and can undergo various chemical transformations
Organic synthesis
Used as a building block for various drug molecules
Pharmaceutical research
Serves as an important intermediate in the synthesis of pharmaceuticals
Coordination chemistry
Can be used as a ligand
Reactivity
The thiol group in the structure allows for various chemical transformations, making it a versatile compound in the synthesis of different molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 6317-17-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,1 and 7 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 6317-17:
(6*6)+(5*3)+(4*1)+(3*7)+(2*1)+(1*7)=85
85 % 10 = 5
So 6317-17-5 is a valid CAS Registry Number.
InChI:InChI=1/C7H11NO3S2/c9-6(10)5-13-7(12)8-1-3-11-4-2-8/h1-5H2,(H,9,10)
