6317-55-1 Usage
Uses
Used in Pharmaceutical Applications:
(E)-(3-(Hydroxy(oxido)amino)phenyl)(phenyl)methanone hydrazone is used as a compound with potential pharmaceutical applications due to its biological activities, such as antioxidant and antimicrobial properties. These properties make it a candidate for the development of new drugs and therapies.
Used in Organic Synthesis:
In the field of organic synthesis, (E)-(3-(Hydroxy(oxido)amino)phenyl)(phenyl)methanone hydrazone is used as a key intermediate for the synthesis of various complex organic molecules. Its unique structure allows for further functionalization and modification, leading to the creation of novel compounds with diverse applications.
Used in Analytical Chemistry and Environmental Monitoring:
(E)-(3-(Hydroxy(oxido)amino)phenyl)(phenyl)methanone hydrazone is used as a complexing agent for transition metal ions in analytical chemistry. Its ability to form stable complexes makes it a valuable tool for the detection, quantification, and analysis of metal ions in various samples, including environmental and industrial applications.
Used in Corrosion Inhibition:
In the field of materials science, (E)-(3-(Hydroxy(oxido)amino)phenyl)(phenyl)methanone hydrazone is used as a potential corrosion inhibitor. Its ability to interact with metal surfaces and form protective layers can help prevent corrosion and extend the lifespan of materials used in various industries.
Used in Coordination Chemistry:
(E)-(3-(Hydroxy(oxido)amino)phenyl)(phenyl)methanone hydrazone is also used as a potential ligand in coordination chemistry. Its unique structure allows it to coordinate with metal ions, forming complexes with potential applications in catalysis, sensing, and other areas of chemistry and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 6317-55-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,1 and 7 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 6317-55:
(6*6)+(5*3)+(4*1)+(3*7)+(2*5)+(1*5)=91
91 % 10 = 1
So 6317-55-1 is a valid CAS Registry Number.
InChI:InChI=1/C13H11N3O2/c14-15-13(10-5-2-1-3-6-10)11-7-4-8-12(9-11)16(17)18/h1-9H,14H2/b15-13+
