6318-01-0 Usage
General Description
2,4-dichloro-N-(4-chlorophenyl)-5,6,7,8-tetrahydroquinazoline-6-carboxamide is a chemical compound with a complex structure that includes two chlorine atoms and a 4-chlorophenyl group. It also contains a tetrahydroquinazoline ring and a carboxamide functional group. This chemical may have various potential applications in the field of medicine, such as in the development of pharmaceutical drugs or as a research tool in the study of biological processes. Its specific properties and potential uses would need to be further investigated through scientific research and experimentation.
Check Digit Verification of cas no
The CAS Registry Mumber 6318-01-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,1 and 8 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 6318-01:
(6*6)+(5*3)+(4*1)+(3*8)+(2*0)+(1*1)=80
80 % 10 = 0
So 6318-01-0 is a valid CAS Registry Number.
InChI:InChI=1/C15H12Cl3N3O/c16-9-2-4-10(5-3-9)19-14(22)8-1-6-12-11(7-8)13(17)21-15(18)20-12/h2-5,8H,1,6-7H2,(H,19,22)