6319-50-2 Usage
Uses
Used in Pharmaceutical Industry:
AKOS B018349 is used as an intermediate in the synthesis of pharmaceuticals for its potential biological activity, contributing to the development of new drug candidates.
Used in Dye Industry:
AKOS B018349 is used as an intermediate in the synthesis of dyes, playing a crucial role in the production of various colorants.
Used in Agricultural Industry:
AKOS B018349 is used in agricultural applications due to its unique chemical properties, potentially contributing to the development of new agrochemicals or enhancing existing ones.
Used in Industrial Applications:
AKOS B018349 is utilized in various industrial applications, leveraging its chemical structure and properties for diverse uses, such as in the manufacturing of specific organic compounds or as a component in chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 6319-50-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,1 and 9 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 6319-50:
(6*6)+(5*3)+(4*1)+(3*9)+(2*5)+(1*0)=92
92 % 10 = 2
So 6319-50-2 is a valid CAS Registry Number.
InChI:InChI=1/C12H11NO2S2/c1-2-15-9-6-4-3-5-8(9)7-10-11(14)13-12(16)17-10/h3-7H,2H2,1H3,(H,13,14,16)/b10-7+
