6320-18-9 Usage
Uses
Used in Pharmaceutical Industry:
Octane-3,5-dione is used as a chemical intermediate for the production of various pharmaceuticals. Its unique structure allows it to be a key component in the synthesis of different medicinal compounds, contributing to the development of new drugs and therapies.
Used in Perfume Industry:
In the perfume industry, Octane-3,5-dione is utilized as a chemical intermediate in the creation of various fragrances. Its ability to react with other compounds enables the production of unique scents and aromas, enhancing the variety of perfumes available in the market.
Used in Polymer Industry:
Octane-3,5-dione serves as a chemical intermediate in the synthesis of polymers. Its involvement in the production process helps create a diverse range of polymers with specific properties, catering to various applications in different industries.
Used as a Flavoring Agent in the Food Industry:
Octane-3,5-dione is employed as a flavoring agent in the food industry. Its ability to impart specific tastes and aromas to food products makes it a valuable component in the creation of various food items, enhancing their overall appeal to consumers.
Used in the Synthesis of Novel Materials:
Octane-3,5-dione has been studied for its potential as a building block for the synthesis of novel materials. Its unique chemical properties make it a promising candidate for the development of new materials with specific characteristics, opening up possibilities for various applications.
Used as a Precursor for the Preparation of Chiral Ligands:
In the field of asymmetric catalysis, Octane-3,5-dione is used as a precursor for the preparation of chiral ligands. Its involvement in the synthesis of these ligands is crucial for the development of enantioselective catalysts, which are essential for producing chiral compounds with specific configurations.
Despite its versatile applications, it is important to note that Octane-3,5-dione is considered a hazardous chemical and should be handled with appropriate safety precautions to ensure the well-being of individuals and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 6320-18-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,2 and 0 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 6320-18:
(6*6)+(5*3)+(4*2)+(3*0)+(2*1)+(1*8)=69
69 % 10 = 9
So 6320-18-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H14O2/c1-3-5-8(10)6-7(9)4-2/h3-6H2,1-2H3
6320-18-9Relevant academic research and scientific papers
Oxidation of alkylphenylacetylenes and dialkylacetylenes on palladium catalysts in DMSO
Yusubov,Filimonov,Chi, Ki-Whan
, p. 649 - 653 (2007/10/03)
Alkylphenyl-and dialkylacetylenes are oxidized by the DMSO-PdCl2 or DMSO-Pd/C system to give the corresponding 1,2-diketones. Oxidation of these compounds, unlike that of diarylacetylenes, is less selective and is accompanied by the partial cle
