63216-89-7 Usage
General Description
2-benzo[f]quinolin-3-yl-1H-indene-1,3(2H)-dione is a specific chemical compound that belongs to the class of organic compounds known as quinoline and derivatives. These are compounds containing a quinoline moiety, which consists of a benzene ring fused to a pyridine ring to form quinoline. Its detailed molecular structure involves several rings of carbon atoms, including a quinoline and indene groups. As a specific scientific compound, its potential applications and utilizations vary across different scientific fields and it might be subjected to further researches to explore its properties and possible uses. However, specific detailed information about the source, utilization, and potential impact of this chemical compound on human health or the environment seems to be limited and requires scientific expertise for accurate interpretation.
Check Digit Verification of cas no
The CAS Registry Mumber 63216-89-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,2,1 and 6 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 63216-89:
(7*6)+(6*3)+(5*2)+(4*1)+(3*6)+(2*8)+(1*9)=117
117 % 10 = 7
So 63216-89-7 is a valid CAS Registry Number.
InChI:InChI=1/C22H13NO2/c24-21-16-7-3-4-8-17(16)22(25)20(21)19-12-10-15-14-6-2-1-5-13(14)9-11-18(15)23-19/h1-12,20H